CAS 1353947-83-7: 2-Amino-N-(1-isoquinolinylmethyl)acetamide
Description:2-Amino-N-(1-isoquinolinylmethyl)acetamide is a chemical compound characterized by its amide functional group, which features an amino group and an isoquinoline moiety. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents due to the presence of the amino group. The isoquinoline structure contributes to its aromatic character, which may influence its reactivity and interaction with biological systems. The presence of the acetamide group suggests that it may participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry or as a pharmacophore in medicinal chemistry. Additionally, the compound may exhibit biological activity, making it of interest in drug development and research. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 2-Amino-N-(1-isoquinolinylmethyl)acetamide represents a versatile structure with potential applications in various fields of chemistry and biochemistry.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c13-7-12(16)15-8-11-10-4-2-1-3-9(10)5-6-14-11/h1-6H,7-8,13H2,(H,15,16)
InChI key:InChIKey=ZOEIYZKEEJPQHB-UHFFFAOYSA-N
SMILES:O=C(NCC1=NC=CC=2C=CC=CC21)CN
- Synonyms:
- 2-Amino-N-(1-isoquinolinylmethyl)acetamide
- Acetamide, 2-amino-N-(1-isoquinolinylmethyl)-