CAS 1353947-85-9

N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-cyclopropylglycine

Description:

N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-cyclopropylglycine, identified by its CAS number 1353947-85-9, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a cyclopropyl group, which contributes to its unique structural properties, and an acetylated pyrrolidine moiety that may influence its biological activity. The presence of both the cyclopropyl and pyrrolidine groups suggests potential interactions with biological targets, possibly affecting neurotransmitter systems. The compound is likely to exhibit characteristics typical of amino acids, such as solubility in polar solvents and the ability to participate in hydrogen bonding. Its specific stereochemistry and functional groups may also impart distinct pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its biological effects and potential applications. As with many chemical substances, safety data and handling precautions should be considered when working with this compound.

Formula: C₁₂H₂₀N₂O₃

InChI: InChI=1S/C12H20N2O3/c1-9(15)13-5-4-10(6-13)7-14(8-12(16)17)11-2-3-11/h10-11H,2-8H2,1H3,(H,16,17)

InChI key: InChIKey=UMZFULHLKNBHEI-UHFFFAOYSA-N

SMILES: N(CC1CN(C(C)=O)CC1)(CC(O)=O)C2CC2

Synonyms:

• N-[(1-Acetyl-3-pyrrolidinyl)methyl]-N-cyclopropylglycine
• Glycine, N-[(1-acetyl-3-pyrrolidinyl)methyl]-N-cyclopropyl-