CymitQuimica logo

CAS 1353947-88-2

:

2-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine

Description:
2-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine, identified by its CAS number 1353947-88-2, is a chemical compound that features a complex structure incorporating a pyrrolidine ring and multiple functional groups. This substance is characterized by the presence of an amine functional group, which contributes to its potential as a ligand in various chemical reactions. The compound's structure suggests it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Additionally, the presence of both isopropyl and benzyl groups may influence its lipophilicity and solubility in organic solvents. Such characteristics could make it relevant in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific biological activities, toxicity, and environmental impact would require further investigation through empirical studies. Overall, this compound's unique structural features position it as a candidate for research in various chemical and biological applications.
Formula:C17H29N3
InChI:InChI=1S/C17H29N3/c1-15(2)20(13-16-7-4-3-5-8-16)14-17-9-6-11-19(17)12-10-18/h3-5,7-8,15,17H,6,9-14,18H2,1-2H3
InChI key:InChIKey=UPQBTMYCCOEVGC-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)C(C)C)C2N(CCN)CCC2
Synonyms:
  • 1-Pyrrolidineethanamine, 2-[[(1-methylethyl)(phenylmethyl)amino]methyl]-
  • 2-[[(1-Methylethyl)(phenylmethyl)amino]methyl]-1-pyrrolidineethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.