CymitQuimica logo

CAS 1353948-10-3

:

2-Chloro-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone

Description:
2-Chloro-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone, with the CAS number 1353948-10-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a piperidine ring, and a cyclopropyl group attached to a phenylmethyl moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity due to the presence of the piperidine and amine functionalities, which may influence its interaction with biological targets. The chloro substituent can enhance lipophilicity, potentially affecting its solubility and permeability. Additionally, the cyclopropyl group may contribute to unique steric and electronic properties, influencing the compound's reactivity and pharmacological profile. As a result, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C18H25ClN2O
InChI:InChI=1S/C18H25ClN2O/c19-11-18(22)20-10-4-7-16(13-20)14-21(17-8-9-17)12-15-5-2-1-3-6-15/h1-3,5-6,16-17H,4,7-14H2
InChI key:InChIKey=CKNXQFBCRRGXFS-UHFFFAOYSA-N
SMILES:N(CC1CN(C(CCl)=O)CCC1)(CC2=CC=CC=C2)C3CC3
Synonyms:
  • Ethanone, 2-chloro-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]-
  • 2-Chloro-1-[3-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.