CymitQuimica logo

CAS 1353948-21-6

:

N<sup>1</sup>-Methyl-N<sup>1</sup>-[(1-methyl-4-piperidinyl)methyl]-1,2-ethanediamine

Description:
N1-Methyl-N1-[(1-methyl-4-piperidinyl)methyl]-1,2-ethanediamine, identified by its CAS number 1353948-21-6, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered ring containing one nitrogen atom, and is substituted with a methyl group and an ethylenediamine moiety. The presence of both the piperidine and the ethylenediamine structures suggests potential biological activity, possibly as a ligand or in pharmacological applications. The compound is likely to exhibit basic properties due to the amine groups, which can participate in hydrogen bonding and interact with various biological targets. Its molecular structure indicates that it may be soluble in polar solvents, and it could potentially have implications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific details regarding its reactivity, stability, and safety profile would require further investigation and characterization through experimental studies.
Formula:C10H23N3
InChI:InChI=1S/C10H23N3/c1-12-6-3-10(4-7-12)9-13(2)8-5-11/h10H,3-9,11H2,1-2H3
InChI key:InChIKey=UEYCEMAKGPMBGX-UHFFFAOYSA-N
SMILES:C(N(CCN)C)C1CCN(C)CC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.