CAS 1353948-27-2
:2-Amino-1-(3-methoxy-1-pyrrolidinyl)ethanone
Description:
2-Amino-1-(3-methoxy-1-pyrrolidinyl)ethanone, identified by its CAS number 1353948-27-2, is a chemical compound that features a pyrrolidine ring substituted with a methoxy group and an amino group attached to an ethanone moiety. This structure suggests that it may exhibit both basic and nucleophilic properties due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and acylation. The methoxy group can influence the compound's solubility and reactivity, potentially enhancing its lipophilicity. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and reactivity.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c1-11-6-2-3-9(5-6)7(10)4-8/h6H,2-5,8H2,1H3
InChI key:InChIKey=NWFUOELYCJKPNX-UHFFFAOYSA-N
SMILES:C(CN)(=O)N1CC(OC)CC1
Synonyms:- 2-Amino-1-(3-methoxy-1-pyrrolidinyl)ethanone
- Ethanone, 2-amino-1-(3-methoxy-1-pyrrolidinyl)-
- 2-amino-1-(3-methoxypyrrolidin-1-yl)ethan-1-one
- 2-AMino-1-(3-Methoxy-pyrrolidin-1-yl)-ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.