CymitQuimica logo

CAS 1353951-48-0

:

2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-N-(1-methylethyl)acetamide

Description:
2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-N-(1-methylethyl)acetamide is a chemical compound characterized by its complex structure, which includes an amino group, a pyridazine ring, and an acetamide moiety. The presence of the methoxy group on the pyridazine ring contributes to its potential for various chemical interactions and biological activities. This compound is likely to exhibit polar characteristics due to the amino and acetamide functional groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. The specific arrangement of substituents may influence its solubility, stability, and reactivity, making it a subject of interest for further research in drug design and synthesis. Additionally, the compound's CAS number, 1353951-48-0, allows for precise identification and retrieval of information regarding its properties and applications in scientific literature.
Formula:C11H18N4O2
InChI:InChI=1S/C11H18N4O2/c1-8(2)15(11(16)6-12)7-9-4-5-10(17-3)14-13-9/h4-5,8H,6-7,12H2,1-3H3
InChI key:InChIKey=GXMIFPVQSJHZES-UHFFFAOYSA-N
SMILES:C(N(C(CN)=O)C(C)C)C1=CC=C(OC)N=N1
Synonyms:
  • Acetamide, 2-amino-N-[(6-methoxy-3-pyridazinyl)methyl]-N-(1-methylethyl)-
  • 2-Amino-N-[(6-methoxy-3-pyridazinyl)methyl]-N-(1-methylethyl)acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.