CymitQuimica logo

CAS 1353952-33-6

:

2-Chloro-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide

Description:
2-Chloro-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide is a chemical compound characterized by its unique structural features, which include a chloro group, a methyl group, and a thienyl moiety. This compound belongs to the class of acetamides and exhibits properties typical of such functional groups, including potential solubility in polar solvents due to the presence of the amide functional group. The thienyl ring contributes to its aromatic character, which may influence its reactivity and interaction with biological systems. The presence of the chloro substituent can enhance its electrophilic nature, making it a candidate for various chemical reactions. Additionally, the compound may exhibit biological activity, which is often explored in pharmaceutical research. Its specific applications and behavior in chemical reactions would depend on the context of use, including the presence of other reactants and the conditions under which reactions are conducted. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and material science.
Formula:C9H10ClNO2S
InChI:InChI=1S/C9H10ClNO2S/c1-11(9(13)5-10)6-7(12)8-3-2-4-14-8/h2-4H,5-6H2,1H3
InChI key:InChIKey=ZHPCZZNTQOBPPL-UHFFFAOYSA-N
SMILES:C(CN(C(CCl)=O)C)(=O)C1=CC=CS1
Synonyms:
  • 2-Chloro-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]acetamide
  • Acetamide, 2-chloro-N-methyl-N-[2-oxo-2-(2-thienyl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.