CymitQuimica logo

CAS 1353952-49-4

:

1-(1,2-Benzisothiazol-3-yl)-4-piperidinol

Description:
1-(1,2-Benzisothiazol-3-yl)-4-piperidinol is a chemical compound characterized by its unique structure, which includes a benzisothiazole moiety and a piperidinol group. This compound typically exhibits properties associated with both heterocyclic and aromatic systems, contributing to its potential biological activity. The presence of the benzisothiazole ring suggests possible applications in medicinal chemistry, as this structure is often linked to various pharmacological effects. The piperidinol portion may enhance solubility and bioavailability, making it a candidate for drug development. Additionally, the compound may display specific interactions with biological targets, which can be explored in the context of therapeutic applications. Its CAS number, 1353952-49-4, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential uses in research and industry. Overall, this compound represents a fascinating area of study within the field of organic and medicinal chemistry, with implications for the development of new therapeutic agents.
Formula:C12H14N2OS
InChI:InChI=1S/C12H14N2OS/c15-9-5-7-14(8-6-9)12-10-3-1-2-4-11(10)16-13-12/h1-4,9,15H,5-8H2
InChI key:InChIKey=WLOKCWSZUDDCPV-UHFFFAOYSA-N
SMILES:OC1CCN(C=2C=3C(SN2)=CC=CC3)CC1
Synonyms:
  • 4-Piperidinol, 1-(1,2-benzisothiazol-3-yl)-
  • 1-(1,2-Benzisothiazol-3-yl)-4-piperidinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.