CAS 1353952-86-9
:N-Cyclopropyl-N-[2-oxo-2-(2-thiazolyl)ethyl]glycine
Description:
N-Cyclopropyl-N-[2-oxo-2-(2-thiazolyl)ethyl]glycine is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiazole moiety. This compound belongs to the class of amino acids and is notable for its potential biological activity, particularly in the context of medicinal chemistry. The presence of the thiazole ring suggests possible interactions with biological targets, making it of interest in drug discovery and development. The compound's structure includes a glycine backbone, which is a simple amino acid, modified by the addition of a cyclopropyl group and a thiazole-derived side chain. Such modifications can influence the compound's solubility, stability, and interaction with biological systems. Additionally, the oxo group contributes to its reactivity and potential for forming various derivatives. Overall, N-Cyclopropyl-N-[2-oxo-2-(2-thiazolyl)ethyl]glycine represents a complex molecule with potential applications in pharmacology and biochemistry.
Formula:C10H12N2O3S
InChI:InChI=1S/C10H12N2O3S/c13-8(10-11-3-4-16-10)5-12(6-9(14)15)7-1-2-7/h3-4,7H,1-2,5-6H2,(H,14,15)
InChI key:InChIKey=QQSKCSUDPGSQOU-UHFFFAOYSA-N
SMILES:N(CC(=O)C1=NC=CS1)(CC(O)=O)C2CC2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery