CAS 1353953-07-7
:Phenylmethyl 3-[[(2-hydroxyethyl)methylamino]methyl]-1-piperidinecarboxylate
Description:
Phenylmethyl 3-[[(2-hydroxyethyl)methylamino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1353953-07-7, is a chemical compound characterized by its complex structure that includes a piperidine ring, a carboxylate group, and a phenylmethyl moiety. This compound typically exhibits properties associated with both amines and esters, which may influence its solubility, reactivity, and potential biological activity. The presence of the hydroxyethyl and methylamino groups suggests that it may engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the piperidine ring contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for its possible therapeutic applications. The compound's molecular interactions and stability can be influenced by factors such as pH and temperature, which are critical for its behavior in biological systems. Overall, this compound's unique structural features may provide insights into its functionality and applications in various chemical and pharmaceutical contexts.
Formula:C17H26N2O3
InChI:InChI=1S/C17H26N2O3/c1-18(10-11-20)12-16-8-5-9-19(13-16)17(21)22-14-15-6-3-2-4-7-15/h2-4,6-7,16,20H,5,8-14H2,1H3
InChI key:InChIKey=LXVYCOAIEUPCKM-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC(CN(CCO)C)CCC2
Synonyms:- Phenylmethyl 3-[[(2-hydroxyethyl)methylamino]methyl]-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-[[(2-hydroxyethyl)methylamino]methyl]-, phenylmethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.