CAS 1353953-26-0
:1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate
Description:
1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate, identified by its CAS number 1353953-26-0, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of a dimethyl group, a piperidine ring, and a cyclopropyl group, which contribute to its unique chemical properties. The compound is likely to exhibit moderate to high solubility in polar solvents due to the presence of amino and carbamate functional groups. Its potential applications may include use in pharmaceuticals or agrochemicals, given the structural motifs that are often associated with biological activity. The presence of the piperidine moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. As with many carbamates, it may also exhibit specific reactivity patterns, such as hydrolysis or interactions with nucleophiles, which are important for its stability and reactivity in various environments. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C16H29N3O3
InChI:InChI=1S/C16H29N3O3/c1-16(2,3)22-15(21)19(13-6-7-13)11-12-5-4-8-18(10-12)14(20)9-17/h12-13H,4-11,17H2,1-3H3
InChI key:InChIKey=YYZREHXLHGCUTJ-UHFFFAOYSA-N
SMILES:N(CC1CN(C(CN)=O)CCC1)(C(OC(C)(C)C)=O)C2CC2
Synonyms:- 1,1-Dimethylethyl N-[[1-(2-aminoacetyl)-3-piperidinyl]methyl]-N-cyclopropylcarbamate
- tert-Butyl N-[[1-(2-aminoacetyl)piperidin-3-yl]methyl]-N-cyclopropylcarbamate
- Carbamic acid, N-[[1-(2-aminoacetyl)-3-piperidinyl]methyl]-N-cyclopropyl-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.