CAS 1353953-35-1
:2-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid
Description:
2-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and an acetic acid moiety. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. The presence of the amino group allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Its piperidine structure provides a cyclic amine framework, which is often associated with various pharmacological activities. The compound's molecular properties, such as polarity and hydrogen bonding capabilities, are influenced by the functional groups present, which can affect its reactivity and interactions in biological systems. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like chromatography. Overall, this compound represents a class of molecules that may have applications in drug development or as intermediates in organic synthesis.
Formula:C13H24N2O4
InChI:InChI=1S/C13H24N2O4/c1-13(2,3)19-12(18)14-8-10-6-4-5-7-15(10)9-11(16)17/h10H,4-9H2,1-3H3,(H,14,18)(H,16,17)
InChI key:InChIKey=GKQDTAZDQABDDV-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(CNC(OC(C)(C)C)=O)CCCC1
Synonyms:- 1-Piperidineacetic acid, 2-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-
- 2-[[[(1,1-Dimethylethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.