CAS 1353953-45-3

3-[[[(1,1-Dimethylethoxy)carbonyl]ethylamino]methyl]-1-pyrrolidineacetic acid

Description:

3-[[[(1,1-Dimethylethoxy)carbonyl]ethylamino]methyl]-1-pyrrolidineacetic acid is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an acetic acid moiety. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group that can influence its reactivity and solubility. This compound likely exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including peptide bond formation. Its structure suggests potential applications in medicinal chemistry, particularly in drug design, where modifications to amino acid structures can lead to enhanced biological activity. The compound's specific stereochemistry and functional groups may also play a crucial role in its interaction with biological targets. Overall, this substance represents a unique combination of features that could be explored for various chemical and pharmaceutical applications.

Formula: C₁₄H₂₆N₂O₄

InChI: InChI=1S/C14H26N2O4/c1-5-16(13(19)20-14(2,3)4)9-11-6-7-15(8-11)10-12(17)18/h11H,5-10H2,1-4H3,(H,17,18)

InChI key: InChIKey=FMYSCLJESCFOPD-UHFFFAOYSA-N

SMILES: C(N(C(OC(C)(C)C)=O)CC)C1CN(CC(O)=O)CC1

Synonyms:

• 1-Pyrrolidineacetic acid, 3-[[[(1,1-dimethylethoxy)carbonyl]ethylamino]methyl]-
• 3-[[[(1,1-Dimethylethoxy)carbonyl]ethylamino]methyl]-1-pyrrolidineacetic acid