CAS 1353953-77-1
:3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineethanol
Description:
3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineethanol, identified by its CAS number 1353953-77-1, is a chemical compound characterized by its unique structure that includes a pyrrolidine ring and a cyclopropylmethylamino group. This compound features a hydroxyl group (-OH) attached to the pyrrolidine, which contributes to its potential solubility in polar solvents. The presence of the cyclopropyl group may influence its steric properties and biological activity, making it of interest in medicinal chemistry. The compound's molecular framework suggests potential interactions with biological targets, possibly affecting neurotransmitter systems or other physiological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Given its specific functional groups, it may exhibit properties such as basicity due to the amino group and potential hydrogen bonding capabilities due to the alcohol group. Overall, this compound's unique structure positions it as a candidate for further research in pharmacology and related fields.
Formula:C11H22N2O
InChI:InChI=1S/C11H22N2O/c1-12(11-2-3-11)8-10-4-5-13(9-10)6-7-14/h10-11,14H,2-9H2,1H3
InChI key:InChIKey=GMDJLLFMCOVFSR-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2CN(CCO)CC2
Synonyms:- 3-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineethanol
- 1-Pyrrolidineethanol, 3-[(cyclopropylmethylamino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.