CAS 1353953-80-6

Phenylmethyl N-[4-[(2-aminoacetyl)amino]cyclohexyl]carbamate

Description:

Phenylmethyl N-[4-[(2-aminoacetyl)amino]cyclohexyl]carbamate, identified by its CAS number 1353953-80-6, is a chemical compound that belongs to the class of carbamates. This substance features a phenylmethyl group, which contributes to its aromatic characteristics, and a cyclohexyl moiety that adds to its structural complexity. The presence of amino and acetyl functional groups indicates potential for biological activity, possibly influencing its solubility and reactivity. The compound's structure suggests it may interact with biological systems, potentially serving as a pharmacophore in medicinal chemistry. Its molecular interactions could involve hydrogen bonding due to the amino groups, and the carbamate linkage may enhance stability and bioavailability. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature typically exhibit moderate to high polarity, affecting their behavior in biological and chemical environments. Further studies would be necessary to elucidate its specific applications and biological effects.

Formula: C₁₆H₂₃N₃O₃

InChI: InChI=1S/C16H23N3O3/c17-10-15(20)18-13-6-8-14(9-7-13)19-16(21)22-11-12-4-2-1-3-5-12/h1-5,13-14H,6-11,17H2,(H,18,20)(H,19,21)

InChI key: InChIKey=VZQIYOXPHSGNBZ-UHFFFAOYSA-N

SMILES: N(C(OCC1=CC=CC=C1)=O)C2CCC(NC(CN)=O)CC2

Synonyms:

• Phenylmethyl N-[4-[(2-aminoacetyl)amino]cyclohexyl]carbamate
• Carbamic acid, N-[4-[(2-aminoacetyl)amino]cyclohexyl]-, phenylmethyl ester