CymitQuimica logo

CAS 1353954-15-0

:

2-Amino-1-[3-[[methyl(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone

Description:
2-Amino-1-[3-[[methyl(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone, identified by its CAS number 1353954-15-0, is a synthetic organic compound characterized by its complex structure, which includes an amino group, a piperidine ring, and a ketone functional group. This compound typically exhibits properties associated with amines and ketones, such as basicity and potential reactivity in nucleophilic substitution reactions. The presence of the piperidine ring contributes to its cyclic structure, which can influence its pharmacological properties, making it of interest in medicinal chemistry. The methyl and isopropyl substituents on the nitrogen atom suggest that it may have lipophilic characteristics, potentially affecting its solubility and permeability in biological systems. Additionally, the compound may exhibit biological activity, which could be explored in various therapeutic contexts. However, specific data regarding its toxicity, stability, and detailed reactivity would require further investigation through experimental studies and literature review.
Formula:C12H25N3O
InChI:InChI=1S/C12H25N3O/c1-10(2)14(3)8-11-5-4-6-15(9-11)12(16)7-13/h10-11H,4-9,13H2,1-3H3
InChI key:InChIKey=SQILJTQTTDIVEO-UHFFFAOYSA-N
SMILES:C(N(C(C)C)C)C1CN(C(CN)=O)CCC1
Synonyms:
  • Ethanone, 2-amino-1-[3-[[methyl(1-methylethyl)amino]methyl]-1-piperidinyl]-
  • 2-Amino-1-[3-[[methyl(1-methylethyl)amino]methyl]-1-piperidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.