CymitQuimica logo

CAS 1353954-32-1

:

2-Amino-1-[4-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone

Description:
2-Amino-1-[4-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone, with the CAS number 1353954-32-1, is a chemical compound characterized by its complex structure, which includes an amino group, a piperidine ring, and a cyclopropylmethyl substituent. This compound is typically classified as an organic amine and may exhibit properties such as being a solid at room temperature, depending on its specific formulation and purity. Its molecular structure suggests potential biological activity, possibly interacting with neurotransmitter systems, which could make it of interest in pharmaceutical research. The presence of the piperidine ring often indicates potential applications in medicinal chemistry, particularly in the development of drugs targeting central nervous system disorders. Additionally, the compound's solubility, stability, and reactivity would be influenced by its functional groups and overall molecular geometry. As with many organic compounds, safety and handling precautions are essential, especially when considering its potential effects in biological systems.
Formula:C12H23N3O
InChI:InChI=1S/C12H23N3O/c1-14(11-2-3-11)9-10-4-6-15(7-5-10)12(16)8-13/h10-11H,2-9,13H2,1H3
InChI key:InChIKey=WRKPOCCTKRESMY-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2CCN(C(CN)=O)CC2
Synonyms:
  • Ethanone, 2-amino-1-[4-[(cyclopropylmethylamino)methyl]-1-piperidinyl]-
  • 2-Amino-1-[4-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.