CymitQuimica logo

CAS 1353954-34-3

:

4-Piperidinemethanamine, N-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1)

Description:
4-Piperidinemethanamine, N-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and thiazole moieties, which contribute to its biological activity. The piperidine ring provides a basic nitrogen atom, making the compound a potential ligand for various receptors. The thiazole group enhances its pharmacological properties, often associated with antimicrobial or anti-inflammatory activities. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in biological studies or pharmaceutical formulations. The compound's structure suggests it may interact with biological systems, potentially influencing neurotransmitter pathways or exhibiting other therapeutic effects. Its specific applications and efficacy would depend on further research, including in vitro and in vivo studies. Safety and handling precautions are essential, as with any chemical substance, particularly those with biological activity. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and drug development.
Formula:C11H19N3S·ClH
InChI:InChI=1S/C11H19N3S.ClH/c1-9(11-13-6-7-15-11)14-8-10-2-4-12-5-3-10;/h6-7,9-10,12,14H,2-5,8H2,1H3;1H
InChI key:InChIKey=YHWKQURNNUJCSC-UHFFFAOYSA-N
SMILES:C(NCC1CCNCC1)(C)C2=NC=CS2.Cl
Synonyms:
  • 4-Piperidinemethanamine, N-[1-(2-thiazolyl)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.