CAS 1353954-35-4

4-[[Cyclopropyl[(phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid

Description:

4-[[Cyclopropyl[(phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring, a cyclopropyl group, and a phenylmethoxycarbonyl moiety. This compound typically exhibits properties associated with amino acids and their derivatives, such as potential solubility in polar solvents due to the presence of both hydrophobic and hydrophilic groups. The piperidine ring contributes to its basicity, while the carboxylic acid functional group imparts acidic characteristics. The cyclopropyl group may influence the compound's steric properties and reactivity, potentially affecting its biological activity. Such compounds are often studied for their pharmacological properties, including potential roles as intermediates in drug synthesis or as active pharmaceutical ingredients. The presence of the phenylmethoxy group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structural features may confer specific biological activities, warranting further investigation in drug development contexts.

Formula: C₁₉H₂₆N₂O₄

InChI: InChI=1S/C19H26N2O4/c22-18(23)13-20-10-8-15(9-11-20)12-21(17-6-7-17)19(24)25-14-16-4-2-1-3-5-16/h1-5,15,17H,6-14H2,(H,22,23)

InChI key: InChIKey=HLKXMSJXXLHDNP-UHFFFAOYSA-N

SMILES: N(CC1CCN(CC(O)=O)CC1)(C(OCC2=CC=CC=C2)=O)C3CC3

Synonyms:

• 4-[[Cyclopropyl[(phenylmethoxy)carbonyl]amino]methyl]-1-piperidineacetic acid
• 1-Piperidineacetic acid, 4-[[cyclopropyl[(phenylmethoxy)carbonyl]amino]methyl]-