CAS 1353954-38-7

2-[[Methyl[(phenylmethoxy)carbonyl]amino]methyl]-1-pyrrolidineacetic acid

Description:

2-[[Methyl[(phenylmethoxy)carbonyl]amino]methyl]-1-pyrrolidineacetic acid is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an acetic acid moiety. This compound features a methyl group attached to a phenylmethoxycarbonyl group, indicating the presence of both aromatic and aliphatic components. The pyrrolidine ring contributes to its cyclic structure, which can influence its reactivity and biological activity. The presence of the amino group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure may impart specific solubility and stability characteristics, which are crucial for its application in pharmaceuticals. As with many compounds containing multiple functional groups, its behavior in various chemical environments can vary significantly, affecting its synthesis, reactivity, and potential therapeutic uses. Understanding these characteristics is essential for researchers working with this compound in drug development or other chemical applications.

Formula: C₁₆H₂₂N₂O₄

InChI: InChI=1S/C16H22N2O4/c1-17(10-14-8-5-9-18(14)11-15(19)20)16(21)22-12-13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,19,20)

InChI key: InChIKey=DTLOXENQPUGZCG-UHFFFAOYSA-N

SMILES: C(N(C(OCC1=CC=CC=C1)=O)C)C2N(CC(O)=O)CCC2

Synonyms:

• 2-[[Methyl[(phenylmethoxy)carbonyl]amino]methyl]-1-pyrrolidineacetic acid
• 1-Pyrrolidineacetic acid, 2-[[methyl[(phenylmethoxy)carbonyl]amino]methyl]-