CAS 1353954-42-3
:2-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid
Description:
2-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid, identified by its CAS number 1353954-42-3, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a cyclopropylmethylamino group, contributing to its unique structural and functional properties. The presence of the acetic acid moiety suggests that it may exhibit acidic behavior, which can influence its solubility and reactivity in various environments. The compound's structure may allow for interactions with biological systems, potentially making it of interest in medicinal chemistry or pharmacology. Its specific stereochemistry, solubility, and reactivity would depend on the arrangement of its substituents and the overall three-dimensional conformation. As with many organic compounds, its properties such as melting point, boiling point, and spectral characteristics would be determined through experimental methods. Overall, this compound's unique structure suggests potential applications in various fields, including drug development and synthetic chemistry.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-12(9-4-5-9)7-10-3-2-6-13(10)8-11(14)15/h9-10H,2-8H2,1H3,(H,14,15)
InChI key:InChIKey=LAYLFNYLFBFZBS-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2N(CC(O)=O)CCC2
Synonyms:- 2-[(Cyclopropylmethylamino)methyl]-1-pyrrolidineacetic acid
- 1-Pyrrolidineacetic acid, 2-[(cyclopropylmethylamino)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.