CAS 1353954-49-0
:N-[4-[(1-Methylethyl)[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine
Description:
N-[4-[(1-Methylethyl)[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine, with CAS number 1353954-49-0, is a synthetic organic compound characterized by its complex structure, which includes a cyclohexyl group, an amino acid moiety (glycine), and a phenylmethoxycarbonyl group. This compound is typically classified as an amino acid derivative and may exhibit properties such as solubility in organic solvents and moderate polarity due to the presence of both hydrophobic and hydrophilic functional groups. Its structure suggests potential applications in pharmaceuticals, particularly in drug design, where modifications to amino acids can enhance bioactivity or selectivity. The presence of the isopropyl group and the phenylmethoxy moiety may contribute to its stability and interaction with biological targets. As with many synthetic compounds, its behavior in biological systems, including pharmacokinetics and toxicity, would require thorough investigation to determine its suitability for therapeutic use.
Formula:C19H28N2O4
InChI:InChI=1S/C19H28N2O4/c1-14(2)21(19(24)25-13-15-6-4-3-5-7-15)17-10-8-16(9-11-17)20-12-18(22)23/h3-7,14,16-17,20H,8-13H2,1-2H3,(H,22,23)
InChI key:InChIKey=RCAFUJCWZGLNPA-UHFFFAOYSA-N
SMILES:N(C(OCC1=CC=CC=C1)=O)(C(C)C)C2CCC(NCC(O)=O)CC2
Synonyms:- Glycine, N-[4-[(1-methylethyl)[(phenylmethoxy)carbonyl]amino]cyclohexyl]-
- N-[4-[(1-Methylethyl)[(phenylmethoxy)carbonyl]amino]cyclohexyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.