CAS 1353954-54-7

Phenylmethyl 3-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate

Description:

Phenylmethyl 3-[[[2-chloroacetyl](1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring, a phenylmethyl group, and a chloroacetyl moiety. This compound typically exhibits properties associated with both amides and esters due to the presence of the carboxylate group. It is likely to be a solid at room temperature, with potential solubility in organic solvents such as ethanol or dimethyl sulfoxide, while being less soluble in water due to its hydrophobic components. The chloroacetyl group may impart reactivity, making it a candidate for further chemical modifications or reactions. Additionally, the presence of the pyrrolidine ring suggests potential biological activity, as many pyrrolidine derivatives are known for their pharmacological properties. Safety data and handling precautions should be considered, as the chloroacetyl group can be hazardous. Overall, this compound's unique structure may lead to applications in medicinal chemistry or as an intermediate in organic synthesis.

Formula: C₁₈H₂₅ClN₂O₃

InChI: InChI=1S/C18H25ClN2O3/c1-14(2)21(17(22)10-19)12-16-8-9-20(11-16)18(23)24-13-15-6-4-3-5-7-15/h3-7,14,16H,8-13H2,1-2H3

InChI key: InChIKey=OFVCZJGGIOWEKJ-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)C(C)C)C1CN(C(OCC2=CC=CC=C2)=O)CC1

Synonyms:

• Phenylmethyl 3-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-[[(2-chloroacetyl)(1-methylethyl)amino]methyl]-, phenylmethyl ester