CymitQuimica logo

CAS 1353954-58-1

:

1-[4-(2-Hydroxyethyl)-2-methyl-1-piperazinyl]ethanone

Description:
1-[4-(2-Hydroxyethyl)-2-methyl-1-piperazinyl]ethanone, identified by its CAS number 1353954-58-1, is a chemical compound characterized by its piperazine structure, which includes a hydroxyl group and an ethanone moiety. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group, which enhances its ability to interact with water and other polar substances. The piperazine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the 2-methyl group may influence its steric properties and reactivity. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific stability data would depend on environmental factors such as temperature and pH. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Overall, this compound's unique structural features position it as a candidate for further investigation in various chemical and biological contexts.
Formula:C9H18N2O2
InChI:InChI=1S/C9H18N2O2/c1-8-7-10(5-6-12)3-4-11(8)9(2)13/h8,12H,3-7H2,1-2H3
InChI key:InChIKey=IUVYFHGVFWHMMW-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C(C)CN(CCO)CC1
Synonyms:
  • 1-[4-(2-Hydroxyethyl)-2-methyl-1-piperazinyl]ethanone
  • Ethanone, 1-[4-(2-hydroxyethyl)-2-methyl-1-piperazinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.