CAS 1353954-73-0
:3-[[Ethyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol
Description:
3-[[Ethyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and an ethanol moiety. The presence of an ethyl group and a phenylmethyl substituent indicates that it has both aliphatic and aromatic characteristics, contributing to its potential biological activity. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The pyrrolidine ring adds to its cyclic nature, potentially affecting its conformational flexibility and interaction with biological targets. Given its structural features, it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychological conditions. However, specific data regarding its pharmacological effects, toxicity, and applications would require further investigation through empirical studies and literature review.
Formula:C16H26N2O
InChI:InChI=1S/C16H26N2O/c1-2-17(12-15-6-4-3-5-7-15)13-16-8-9-18(14-16)10-11-19/h3-7,16,19H,2,8-14H2,1H3
InChI key:InChIKey=BJKGRXLGDNZUTM-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)CC)C2CN(CCO)CC2
Synonyms:- 1-Pyrrolidineethanol, 3-[[ethyl(phenylmethyl)amino]methyl]-
- 3-[[Ethyl(phenylmethyl)amino]methyl]-1-pyrrolidineethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.