CymitQuimica logo

CAS 1353954-84-3

:

2-[[2-(Dimethylamino)cyclohexyl](1-methylethyl)amino]ethanol

Description:
2-[[2-(Dimethylamino)cyclohexyl](1-methylethyl)amino]ethanol, identified by its CAS number 1353954-84-3, is a chemical compound that features a complex structure characterized by the presence of a cyclohexyl group, dimethylamino functionality, and an ethanol moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds due to the presence of hydroxyl (-OH) and amino (-NH) groups. The dimethylamino group contributes to its potential as a nucleophile in various chemical reactions. Additionally, the cyclohexyl ring may influence its steric properties and overall molecular conformation, affecting its reactivity and interaction with biological systems. The presence of an isopropyl group (1-methylethyl) may also enhance lipophilicity, impacting its solubility in organic solvents. Overall, this compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or as intermediates in organic synthesis.
Formula:C13H28N2O
InChI:InChI=1S/C13H28N2O/c1-11(2)15(9-10-16)13-8-6-5-7-12(13)14(3)4/h11-13,16H,5-10H2,1-4H3
InChI key:InChIKey=FUGWAFHEEDYZQR-UHFFFAOYSA-N
SMILES:N(CCO)(C(C)C)C1C(N(C)C)CCCC1
Synonyms:
  • Ethanol, 2-[[2-(dimethylamino)cyclohexyl](1-methylethyl)amino]-
  • 2-[[2-(Dimethylamino)cyclohexyl](1-methylethyl)amino]ethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.