CAS 1353954-88-7

2-Chloro-1-[2-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone

Description:

2-Chloro-1-[2-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone, with the CAS number 1353954-88-7, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a piperidine ring, and a cyclopropyl group attached to a phenylmethyl moiety. This compound typically exhibits properties associated with its functional groups, such as potential basicity due to the piperidine nitrogen and reactivity due to the presence of the chloro substituent. It may also demonstrate moderate lipophilicity, which can influence its pharmacokinetic properties if studied in a biological context. The presence of the cyclopropyl group may impart unique steric and electronic characteristics, potentially affecting its interaction with biological targets. As a result, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₈H₂₅ClN₂O

InChI: InChI=1S/C18H25ClN2O/c19-12-18(22)21-11-5-4-8-17(21)14-20(16-9-10-16)13-15-6-2-1-3-7-15/h1-3,6-7,16-17H,4-5,8-14H2

InChI key: InChIKey=RNGZYGVERPLAIJ-UHFFFAOYSA-N

SMILES: N(CC1N(C(CCl)=O)CCCC1)(CC2=CC=CC=C2)C3CC3

Synonyms:

• Ethanone, 2-chloro-1-[2-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]-
• 2-Chloro-1-[2-[[cyclopropyl(phenylmethyl)amino]methyl]-1-piperidinyl]ethanone