CymitQuimica logo

CAS 1353955-15-3

:

2-Amino-N-[(2-cyanophenyl)methyl]-N-cyclopropylacetamide

Description:
2-Amino-N-[(2-cyanophenyl)methyl]-N-cyclopropylacetamide is a chemical compound characterized by its unique structural features, which include an amino group, a cyanophenyl moiety, and a cyclopropyl group attached to an acetamide backbone. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the amino and acetamide functional groups, which can engage in hydrogen bonding. The presence of the cyanophenyl group may impart specific electronic properties, potentially influencing its reactivity and interactions with biological targets. Additionally, the cyclopropyl group can contribute to the compound's three-dimensional conformation, affecting its pharmacological profile if it is intended for medicinal use. The compound's molecular weight, melting point, and other physical properties would depend on its specific structure and purity. Overall, 2-Amino-N-[(2-cyanophenyl)methyl]-N-cyclopropylacetamide represents a complex organic molecule with potential applications in pharmaceuticals or chemical research, warranting further investigation into its biological activity and synthesis.
Formula:C13H15N3O
InChI:InChI=1S/C13H15N3O/c14-7-10-3-1-2-4-11(10)9-16(12-5-6-12)13(17)8-15/h1-4,12H,5-6,8-9,15H2
InChI key:InChIKey=OAPMBZBGCWXCQV-UHFFFAOYSA-N
SMILES:N(CC1=C(C#N)C=CC=C1)(C(CN)=O)C2CC2
Synonyms:
  • 2-Amino-N-[(2-cyanophenyl)methyl]-N-cyclopropylacetamide
  • Acetamide, 2-amino-N-[(2-cyanophenyl)methyl]-N-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.