CymitQuimica logo

CAS 1353955-35-7

:

N1-(1-Methylethyl)-N1-[(3-nitrophenyl)methyl]-1,2-ethanediamine

Description:
N1-(1-Methylethyl)-N1-[(3-nitrophenyl)methyl]-1,2-ethanediamine, identified by its CAS number 1353955-35-7, is a chemical compound characterized by its amine functional groups and a substituted aromatic ring. This compound features a branched alkyl group (isopropyl) and a nitrophenyl moiety, which can influence its reactivity and solubility. The presence of the nitro group typically imparts polar characteristics, potentially enhancing the compound's interactions in biological systems. The ethylenediamine backbone suggests that it may participate in coordination chemistry, possibly forming complexes with metal ions. Additionally, the structural features indicate potential applications in pharmaceuticals or agrochemicals, where such amine derivatives are often explored for their biological activity. The compound's stability, solubility, and reactivity would depend on the specific conditions, including pH and solvent environment. Overall, this compound exemplifies the diversity of amine chemistry and its relevance in various chemical applications.
Formula:C12H19N3O2
InChI:InChI=1S/C12H19N3O2/c1-10(2)14(7-6-13)9-11-4-3-5-12(8-11)15(16)17/h3-5,8,10H,6-7,9,13H2,1-2H3
InChI key:InChIKey=RKGOTUNTPJCCJK-UHFFFAOYSA-N
SMILES:C(N(CCN)C(C)C)C1=CC(N(=O)=O)=CC=C1
Synonyms:
  • N1-(1-Methylethyl)-N1-[(3-nitrophenyl)methyl]-1,2-ethanediamine
  • 1,2-Ethanediamine, N1-(1-methylethyl)-N1-[(3-nitrophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.