CAS 1353955-58-4

2-Amino-N-[4-(dimethylamino)cyclohexyl]-N-(1-methylethyl)acetamide

Description:

2-Amino-N-[4-(dimethylamino)cyclohexyl]-N-(1-methylethyl)acetamide is a chemical compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical agent. The presence of an amino group suggests it may exhibit basic properties, while the dimethylamino group contributes to its lipophilicity, potentially enhancing its ability to cross biological membranes. The cyclohexyl moiety adds to the compound's steric bulk, which can influence its interaction with biological targets. This compound may be of interest in medicinal chemistry due to its structural features that could confer specific biological activities, such as receptor binding or enzyme inhibition. Its molecular structure suggests it may participate in hydrogen bonding, which is crucial for solubility and reactivity. Additionally, the presence of the isopropyl group may affect its pharmacokinetic properties, such as absorption and distribution. Overall, the unique combination of functional groups and structural elements makes this compound a candidate for further investigation in drug development and related fields.

Formula: C₁₃H₂₇N₃O

InChI: InChI=1S/C13H27N3O/c1-10(2)16(13(17)9-14)12-7-5-11(6-8-12)15(3)4/h10-12H,5-9,14H2,1-4H3

InChI key: InChIKey=CNKYAUDRFAQNBC-UHFFFAOYSA-N

SMILES: N(C(CN)=O)(C(C)C)C1CCC(N(C)C)CC1

Synonyms:

• Acetamide, 2-amino-N-[4-(dimethylamino)cyclohexyl]-N-(1-methylethyl)-
• 2-Amino-N-[4-(dimethylamino)cyclohexyl]-N-(1-methylethyl)acetamide