CAS 1353955-81-3
:N<sup>1</sup>-[(2-Bromophenyl)methyl]-N<sup>1</sup>-cyclopropyl-1,2-ethanediamine
Description:
N1-[(2-Bromophenyl)methyl]-N1-cyclopropyl-1,2-ethanediamine is a chemical compound characterized by its unique structure, which includes a cyclopropyl group and a bromophenyl moiety. This compound features two amine groups, making it a diamine, and is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The presence of the bromine atom on the phenyl ring may influence its reactivity and solubility, potentially enhancing its lipophilicity. The cyclopropyl group can introduce strain and unique steric effects, which may affect the compound's biological activity and interaction with receptors or enzymes. Given its structural complexity, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 1353955-81-3, allows for precise identification and retrieval of information regarding its synthesis, properties, and potential applications in research and industry.
Formula:C12H17BrN2
InChI:InChI=1S/C12H17BrN2/c13-12-4-2-1-3-10(12)9-15(8-7-14)11-5-6-11/h1-4,11H,5-9,14H2
InChI key:InChIKey=XRRUQRFGMVUOQK-UHFFFAOYSA-N
SMILES:N(CC1=C(Br)C=CC=C1)(CCN)C2CC2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.