CAS 1353956-10-1
:2-[[[(1,1-Dimethylethoxy)carbonyl](1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid
Description:
2-[[[(1,1-Dimethylethoxy)carbonyl](1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid is a synthetic organic compound characterized by its complex structure, which includes a pyrrolidine ring and an acetic acid moiety. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. The presence of the amino group indicates potential for forming hydrogen bonds, enhancing its reactivity and interaction with biological systems. Its molecular structure suggests it may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. The compound's CAS number, 1353956-10-1, allows for precise identification in chemical databases. As with many compounds containing both amine and carboxylic acid functionalities, it may participate in various chemical reactions, including esterification and amidation. Overall, this compound's unique characteristics position it as a potential candidate for further research in drug development and related fields.
Formula:C15H28N2O4
InChI:InChI=1S/C15H28N2O4/c1-11(2)17(14(20)21-15(3,4)5)9-12-7-6-8-16(12)10-13(18)19/h11-12H,6-10H2,1-5H3,(H,18,19)
InChI key:InChIKey=YJHDPAZVKYQWSV-UHFFFAOYSA-N
SMILES:C(N(C(OC(C)(C)C)=O)C(C)C)C1N(CC(O)=O)CCC1
Synonyms:- 2-[[[(1,1-Dimethylethoxy)carbonyl](1-methylethyl)amino]methyl]-1-pyrrolidineacetic acid
- 1-Pyrrolidineacetic acid, 2-[[[(1,1-dimethylethoxy)carbonyl](1-methylethyl)amino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.