CAS 1353956-28-1
:Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]carbamate
Description:
Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]carbamate, identified by its CAS number 1353956-28-1, is a synthetic organic compound characterized by its complex molecular structure. It features a carbamate functional group, which is known for its role in various biological activities, including potential applications in pharmaceuticals. The presence of a cyclopropyl group contributes to its unique steric and electronic properties, while the pyrrolidine ring enhances its potential for interaction with biological targets. The hydroxyethyl substituent may influence solubility and reactivity, making it relevant for medicinal chemistry. This compound is likely to exhibit specific pharmacological effects, although detailed studies would be necessary to elucidate its mechanism of action and therapeutic potential. As with many synthetic compounds, safety and handling precautions are essential, and its stability under various conditions should be assessed for practical applications. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic interventions.
Formula:C18H26N2O3
InChI:InChI=1S/C18H26N2O3/c21-12-11-19-10-4-7-17(19)13-20(16-8-9-16)18(22)23-14-15-5-2-1-3-6-15/h1-3,5-6,16-17,21H,4,7-14H2
InChI key:InChIKey=HSAXWQNGUQXTID-UHFFFAOYSA-N
SMILES:N(CC1N(CCO)CCC1)(C(OCC2=CC=CC=C2)=O)C3CC3
Synonyms:- Phenylmethyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]carbamate
- Carbamic acid, N-cyclopropyl-N-[[1-(2-hydroxyethyl)-2-pyrrolidinyl]methyl]-, phenylmethyl ester
- Benzyl N-cyclopropyl-N-[[1-(2-hydroxyethyl)pyrrolidin-2-yl]methyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.