CAS 1353956-52-1

1-[4-(2-Aminoethyl)-3-methyl-1-piperazinyl]ethanone

Description:

1-[4-(2-Aminoethyl)-3-methyl-1-piperazinyl]ethanone, identified by its CAS number 1353956-52-1, is a chemical compound characterized by its piperazine structure, which includes a piperazine ring substituted with an aminoethyl group and a methyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the ethanone functional group suggests it may also participate in reactions typical of ketones, such as nucleophilic addition. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the piperazine moiety's prevalence in various bioactive compounds. Additionally, the aminoethyl side chain may enhance its interaction with biological targets, making it of interest for further research in drug design and synthesis. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₉H₁₉N₃O

InChI: InChI=1S/C9H19N3O/c1-8-7-12(9(2)13)6-5-11(8)4-3-10/h8H,3-7,10H2,1-2H3

InChI key: InChIKey=VNGSGLDEJQQTRX-UHFFFAOYSA-N

SMILES: C(CN)N1C(C)CN(C(C)=O)CC1

Synonyms:

• Ethanone, 1-[4-(2-aminoethyl)-3-methyl-1-piperazinyl]-
• 1-[4-(2-Aminoethyl)-3-methyl-1-piperazinyl]ethanone