CAS 1353956-56-5
:2-[[(2-Aminoethyl)cyclopropylamino]methyl]benzonitrile
Description:
2-[[(2-Aminoethyl)cyclopropylamino]methyl]benzonitrile, identified by its CAS number 1353956-56-5, is a chemical compound characterized by its complex structure, which includes a benzonitrile moiety and a cyclopropylamine group. This compound features a benzene ring substituted with a nitrile group and an aminoethyl side chain that is further connected to a cyclopropylamine. The presence of the amino group suggests potential for hydrogen bonding, which may influence its solubility and reactivity. The cyclopropyl group introduces unique steric and electronic properties, potentially affecting the compound's biological activity and interaction with other molecules. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination. Overall, this compound's structural features suggest it could play a role in various chemical and biological applications.
Formula:C13H17N3
InChI:InChI=1S/C13H17N3/c14-7-8-16(13-5-6-13)10-12-4-2-1-3-11(12)9-15/h1-4,13H,5-8,10,14H2
InChI key:InChIKey=LONKBNMDLKLMSY-UHFFFAOYSA-N
SMILES:N(CC1=C(C#N)C=CC=C1)(CCN)C2CC2
Synonyms:- 2-[[(2-Aminoethyl)cyclopropylamino]methyl]benzonitrile
- Benzonitrile, 2-[[(2-aminoethyl)cyclopropylamino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.