CAS 1353956-60-1
:N-[[3-(Methylthio)-2-pyrazinyl]methyl]glycine
Description:
N-[[3-(Methylthio)-2-pyrazinyl]methyl]glycine, identified by its CAS number 1353956-60-1, is a chemical compound that features a pyrazine ring substituted with a methylthio group and a glycine moiety. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity. The presence of the methylthio group enhances its lipophilicity, potentially influencing its interaction with biological targets. The glycine component suggests that it may participate in various biochemical pathways, possibly acting as an amino acid derivative. This compound may exhibit properties relevant to medicinal chemistry, including potential roles in drug development or agricultural applications. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature. As with many chemical substances, safety data and handling precautions are essential for its use in laboratory or industrial settings. Further research would be necessary to fully elucidate its properties and potential applications.
Formula:C8H11N3O2S
InChI:InChI=1S/C8H11N3O2S/c1-14-8-6(10-2-3-11-8)4-9-5-7(12)13/h2-3,9H,4-5H2,1H3,(H,12,13)
InChI key:InChIKey=ZIFHUWVLOSMNIY-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)C=1C(SC)=NC=CN1
Synonyms:- N-[[3-(Methylthio)-2-pyrazinyl]methyl]glycine
- Glycine, N-[[3-(methylthio)-2-pyrazinyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.