CAS 1353957-19-3
:4-(Bromomethyl)-1-piperidineacetic acid
Description:
4-(Bromomethyl)-1-piperidineacetic acid is a chemical compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound features a bromomethyl group attached to the piperidine nitrogen, enhancing its reactivity and potential for further chemical modifications. The presence of the acetic acid moiety contributes to its acidic properties, making it a potential candidate for various applications in medicinal chemistry and organic synthesis. The bromine atom can serve as a leaving group in nucleophilic substitution reactions, facilitating the introduction of other functional groups. Additionally, the piperidine structure is known for its role in pharmacologically active compounds, suggesting that derivatives of this substance may exhibit biological activity. Its molecular structure allows for interactions with biological targets, which could be explored in drug development. Overall, 4-(Bromomethyl)-1-piperidineacetic acid is a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C8H14BrNO2
InChI:InChI=1S/C8H14BrNO2/c9-5-7-1-3-10(4-2-7)6-8(11)12/h7H,1-6H2,(H,11,12)
InChI key:InChIKey=JRYBXZFYJBFBJM-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1CCC(CBr)CC1
Synonyms:- 4-(Bromomethyl)-1-piperidineacetic acid
- 1-Piperidineacetic acid, 4-(bromomethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.