CAS 1353957-32-0

1,1-Dimethylethyl 3-[(2-aminoacetyl)methylamino]-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(2-aminoacetyl)methylamino]-1-pyrrolidinecarboxylate, identified by its CAS number 1353957-32-0, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group, contributing to its steric bulk, and an aminoacetyl group that suggests potential biological activity, possibly related to peptide synthesis or interactions with biological receptors. The carboxylate functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. Its structure suggests that it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can engage in hydrogen bonding and other interactions. Additionally, the compound's stability and reactivity would depend on the specific conditions, such as pH and temperature, making it a candidate for further investigation in various chemical and biological applications.

Formula: C₁₂H₂₃N₃O₃

InChI: InChI=1S/C12H23N3O3/c1-12(2,3)18-11(17)15-6-5-9(8-15)14(4)10(16)7-13/h9H,5-8,13H2,1-4H3

InChI key: InChIKey=RUDYSANJCHECHC-UHFFFAOYSA-N

SMILES: N(C(CN)=O)(C)C1CN(C(OC(C)(C)C)=O)CC1

Synonyms:

• 1,1-Dimethylethyl 3-[(2-aminoacetyl)methylamino]-1-pyrrolidinecarboxylate
• 1-Pyrrolidinecarboxylic acid, 3-[(2-aminoacetyl)methylamino]-, 1,1-dimethylethyl ester