CAS 1353958-33-4

3-(Acetylcyclopropylamino)-1-piperidineacetic acid

Description:

3-(Acetylcyclopropylamino)-1-piperidineacetic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and an acetylcyclopropylamino group. This compound is classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid functional group. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the cyclopropyl group may impart specific steric and electronic properties, influencing its interaction with biological targets. Additionally, the piperidine moiety can enhance solubility and bioavailability. The compound's synthesis typically involves multi-step organic reactions, and its purity and stability are crucial for its application in research or pharmaceutical contexts. As with many compounds in this category, understanding its pharmacokinetics and pharmacodynamics is essential for evaluating its potential therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₁₂H₂₀N₂O₃

InChI: InChI=1S/C12H20N2O3/c1-9(15)14(10-4-5-10)11-3-2-6-13(7-11)8-12(16)17/h10-11H,2-8H2,1H3,(H,16,17)

InChI key: InChIKey=YQYWXBLOAZDKBH-UHFFFAOYSA-N

SMILES: N(C(C)=O)(C1CN(CC(O)=O)CCC1)C2CC2

Synonyms:

• 1-Piperidineacetic acid, 3-(acetylcyclopropylamino)-
• 3-(Acetylcyclopropylamino)-1-piperidineacetic acid