CAS 1353958-36-7
:4-(Acetylcyclopropylamino)-1-piperidineacetic acid
Description:
4-(Acetylcyclopropylamino)-1-piperidineacetic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and an acetylcyclopropylamino group. This compound is classified as an amino acid derivative, incorporating both amine and carboxylic acid functional groups, which contributes to its potential biological activity. The presence of the cyclopropyl group may influence its steric and electronic properties, potentially affecting its interactions with biological targets. The compound's molecular structure suggests it may exhibit specific pharmacological activities, making it of interest in medicinal chemistry. Additionally, its solubility and stability in various solvents can vary, which is crucial for its application in drug formulation and delivery. As with many compounds in this class, understanding its reactivity, synthesis, and potential therapeutic effects requires further investigation through experimental studies. Overall, 4-(Acetylcyclopropylamino)-1-piperidineacetic acid represents a complex molecule with potential implications in pharmaceutical research.
Formula:C12H20N2O3
InChI:InChI=1S/C12H20N2O3/c1-9(15)14(10-2-3-10)11-4-6-13(7-5-11)8-12(16)17/h10-11H,2-8H2,1H3,(H,16,17)
InChI key:InChIKey=JNFFAXQBWBPZCL-UHFFFAOYSA-N
SMILES:N(C(C)=O)(C1CC1)C2CCN(CC(O)=O)CC2
Synonyms:- 4-(Acetylcyclopropylamino)-1-piperidineacetic acid
- 1-Piperidineacetic acid, 4-(acetylcyclopropylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.