CAS 1353958-45-8

2-[(Cyclopropylmethylamino)methyl]-1-piperidineethanol

Description:

2-[(Cyclopropylmethylamino)methyl]-1-piperidineethanol, identified by its CAS number 1353958-45-8, is a chemical compound characterized by its unique structural features, including a piperidine ring and a cyclopropylmethylamino group. This compound typically exhibits properties associated with amines and alcohols, such as potential solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The piperidine moiety contributes to its cyclic structure, which can influence its biological activity and interaction with various receptors. The cyclopropyl group may impart specific steric and electronic properties, affecting the compound's reactivity and pharmacological profile. As with many compounds containing nitrogen, it may exhibit basicity, allowing it to form salts with acids. The presence of multiple functional groups suggests that it could participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Overall, the compound's characteristics are defined by its molecular structure, which influences its physical and chemical behavior in different environments.

Formula: C₁₂H₂₄N₂O

InChI: InChI=1S/C12H24N2O/c1-13(11-5-6-11)10-12-4-2-3-7-14(12)8-9-15/h11-12,15H,2-10H2,1H3

InChI key: InChIKey=ARPSGAJTMJQWRE-UHFFFAOYSA-N

SMILES: C(N(C)C1CC1)C2N(CCO)CCCC2

Synonyms:

• 1-Piperidineethanol, 2-[(cyclopropylmethylamino)methyl]-
• 2-[(Cyclopropylmethylamino)methyl]-1-piperidineethanol