CAS 1353958-64-1
:2-Chloro-1-[2-[[methyl(1-methylethyl)amino]methyl]-1-pyrrolidinyl]ethanone
Description:
2-Chloro-1-[2-[[methyl(1-methylethyl)amino]methyl]-1-pyrrolidinyl]ethanone, identified by its CAS number 1353958-64-1, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a pyrrolidine ring, and an ethanone moiety. This compound typically exhibits properties associated with both amines and ketones, such as potential basicity and reactivity towards nucleophiles. The presence of the chloro substituent can influence its reactivity and solubility in various solvents. It may also exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's molecular structure suggests it could interact with biological systems, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. As with many synthetic compounds, safety and handling precautions are essential, as it may pose risks such as toxicity or environmental hazards. Detailed studies would be necessary to fully understand its properties, including its stability, reactivity, and potential applications in various fields.
Formula:C11H21ClN2O
InChI:InChI=1S/C11H21ClN2O/c1-9(2)13(3)8-10-5-4-6-14(10)11(15)7-12/h9-10H,4-8H2,1-3H3
InChI key:InChIKey=GIYDNXNOTQJZFH-UHFFFAOYSA-N
SMILES:C(N(C(C)C)C)C1N(C(CCl)=O)CCC1
Synonyms:- Ethanone, 2-chloro-1-[2-[[methyl(1-methylethyl)amino]methyl]-1-pyrrolidinyl]-
- 2-Chloro-1-[2-[[methyl(1-methylethyl)amino]methyl]-1-pyrrolidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.