CymitQuimica logo

CAS 1353958-69-6

:

2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone

Description:
2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a piperidine ring, and a cyclopropylmethylamino moiety. This compound typically exhibits properties associated with amines and ketones, such as potential basicity due to the presence of the amino group and reactivity due to the carbonyl functionality. It is likely to be a solid at room temperature, with solubility in polar organic solvents, reflecting its polar functional groups. The presence of the chloro substituent may influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. However, specific biological properties and safety profiles would require further investigation through empirical studies. As with any chemical substance, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C12H21ClN2O
InChI:InChI=1S/C12H21ClN2O/c1-14(11-4-5-11)8-10-3-2-6-15(9-10)12(16)7-13/h10-11H,2-9H2,1H3
InChI key:InChIKey=QWADKQMLXRPETL-UHFFFAOYSA-N
SMILES:C(N(C)C1CC1)C2CN(C(CCl)=O)CCC2
Synonyms:
  • Ethanone, 2-chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-piperidinyl]-
  • 2-Chloro-1-[3-[(cyclopropylmethylamino)methyl]-1-piperidinyl]ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.