CymitQuimica logo

CAS 1353958-75-4

:

2-Amino-1-[3-[(dimethylamino)methyl]-1-pyrrolidinyl]ethanone

Description:
2-Amino-1-[3-[(dimethylamino)methyl]-1-pyrrolidinyl]ethanone, identified by its CAS number 1353958-75-4, is a chemical compound characterized by its complex structure, which includes an amino group and a pyrrolidine ring. This substance typically exhibits properties associated with amines and ketones, such as basicity and potential reactivity with electrophiles. The presence of the dimethylamino group suggests that it may have enhanced nucleophilicity, making it a candidate for various chemical reactions, including alkylation and acylation. Additionally, the pyrrolidine moiety can influence the compound's conformational flexibility and steric properties. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C9H19N3O
InChI:InChI=1S/C9H19N3O/c1-11(2)6-8-3-4-12(7-8)9(13)5-10/h8H,3-7,10H2,1-2H3
InChI key:InChIKey=GRIDBDHZRIIXDP-UHFFFAOYSA-N
SMILES:C(CN)(=O)N1CC(CN(C)C)CC1
Synonyms:
  • 2-Amino-1-[3-[(dimethylamino)methyl]-1-pyrrolidinyl]ethanone
  • Ethanone, 2-amino-1-[3-[(dimethylamino)methyl]-1-pyrrolidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.