CymitQuimica logo

CAS 1353958-76-5

:

[1-(6-Methoxy-2-Methylsulfanyl-pyriMidin-4-yl)-piperidin-4-ylMethyl]-carbaMic acid tert-butyl ester

Description:
The chemical substance known as "[1-(6-Methoxy-2-Methylsulfanyl-pyrimidin-4-yl)-piperidin-4-ylmethyl]-carbamic acid tert-butyl ester" with CAS number 1353958-76-5 is a synthetic organic compound that features a complex structure incorporating a piperidine ring, a pyrimidine moiety, and a tert-butyl carbamate functional group. This compound is characterized by its potential biological activity, which may include interactions with specific receptors or enzymes, making it of interest in medicinal chemistry and drug development. The presence of the methoxy and methylsulfanyl groups suggests that it may exhibit unique electronic and steric properties, influencing its solubility and reactivity. Additionally, the tert-butyl ester group is known to enhance the lipophilicity of the molecule, potentially affecting its pharmacokinetics. Overall, this compound exemplifies the intricate design often employed in the development of pharmaceuticals, where modifications to the molecular structure can lead to significant changes in biological activity and therapeutic potential.
Formula:C17H28N4O3S
InChI:InChI=1S/C17H28N4O3S/c1-17(2,3)24-16(22)18-11-12-6-8-21(9-7-12)13-10-14(23-4)20-15(19-13)25-5/h10,12H,6-9,11H2,1-5H3,(H,18,22)
InChI key:MZVMWFOCKMGZNG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1CCN(CC1)C2=CC(=NC(=N2)SC)OC
Synonyms:
  • tert-Butyl ((1-(6-Methoxy-2-(Methylthio)pyriMidin-4-yl)piperidin-4-yl)Methyl)carbaMate
  • Carbamic acid, N-[[1-[6-methoxy-2-(methylthio)-4-pyrimidinyl]-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
Found 3 products.