CymitQuimica logo

CAS 1353958-90-3

:

1,2-Benzisothiazol-3-amine, N-4-piperidinyl-, hydrochloride (1:1)

Description:
1,2-Benzisothiazol-3-amine, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which combines a benzisothiazole moiety with a piperidine group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for diverse applications in pharmaceuticals and research. The presence of the hydrochloride salt form enhances its stability and solubility. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, due to the functional groups present in its structure. The compound's molecular interactions can be influenced by the piperidine ring, which may contribute to its pharmacological effects. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 1,2-Benzisothiazol-3-amine, N-4-piperidinyl-, hydrochloride is of interest in medicinal chemistry and may serve as a lead compound for further drug development.
Formula:C12H15N3S·ClH
InChI:InChI=1S/C12H15N3S.ClH/c1-2-4-11-10(3-1)12(15-16-11)14-9-5-7-13-8-6-9;/h1-4,9,13H,5-8H2,(H,14,15);1H
InChI key:InChIKey=XZFGMTWDSZMLGF-UHFFFAOYSA-N
SMILES:N(C=1C=2C(SN1)=CC=CC2)C3CCNCC3.Cl
Synonyms:
  • 1,2-Benzisothiazol-3-amine, N-4-piperidinyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.