CAS 1353958-92-5
:1,1-Dimethylethyl 4-(2-aminoethyl)-2-methyl-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-(2-aminoethyl)-2-methyl-1-piperazinecarboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring, an aminoethyl side chain, and a carboxylate functional group. This compound is typically classified as an amino acid derivative due to the presence of the amino group and the carboxylate moiety. It is likely to exhibit properties such as solubility in polar solvents, given the presence of both hydrophilic and hydrophobic regions in its structure. The dimethyl group contributes to steric hindrance, which may influence its reactivity and interactions with biological systems. Additionally, the piperazine ring can impart basicity, making the compound potentially useful in pharmaceutical applications. Its specific characteristics, such as melting point, boiling point, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound may have relevance in medicinal chemistry and could serve as a scaffold for drug development.
Formula:C12H25N3O2
InChI:InChI=1S/C12H25N3O2/c1-10-9-14(6-5-13)7-8-15(10)11(16)17-12(2,3)4/h10H,5-9,13H2,1-4H3
InChI key:InChIKey=JFJOMKBEHWCRSW-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(C)CN(CCN)CC1
Synonyms:- 1-Piperazinecarboxylic acid, 4-(2-aminoethyl)-2-methyl-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(2-aminoethyl)-2-methyl-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.