CymitQuimica logo

CAS 1353959-15-5

:

N1-Ethyl-N1-(1-methyl-3-pyrrolidinyl)-1,2-ethanediamine

Description:
N1-Ethyl-N1-(1-methyl-3-pyrrolidinyl)-1,2-ethanediamine, identified by its CAS number 1353959-15-5, is a chemical compound that belongs to the class of aliphatic amines. This substance features a unique structure characterized by an ethyl group and a pyrrolidine ring, which contributes to its potential biological activity. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The compound is soluble in polar solvents, which is indicative of its amine functional groups. Its molecular structure suggests that it may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. The presence of both primary and secondary amine functionalities may influence its reactivity and ability to form hydrogen bonds, impacting its behavior in biological systems. As with many amines, it may exhibit basic properties and can participate in various chemical reactions, including alkylation and acylation. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.
Formula:C9H21N3
InChI:InChI=1S/C9H21N3/c1-3-12(7-5-10)9-4-6-11(2)8-9/h9H,3-8,10H2,1-2H3
InChI key:InChIKey=QMBZIMOJDMMJJE-UHFFFAOYSA-N
SMILES:N(CCN)(CC)C1CN(C)CC1
Synonyms:
  • 1,2-Ethanediamine, N1-ethyl-N1-(1-methyl-3-pyrrolidinyl)-
  • N1-Ethyl-N1-(1-methyl-3-pyrrolidinyl)-1,2-ethanediamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.