CAS 1353959-25-7
:N1-Ethyl-N1-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine
Description:
N1-Ethyl-N1-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine, identified by its CAS number 1353959-25-7, is a chemical compound characterized by its amine functional groups and piperidine ring structure. This substance features a two-carbon ethylene chain with two amine groups, which contributes to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the piperidine moiety enhances its basicity and may influence its solubility and reactivity in various solvents. Typically, compounds of this nature exhibit moderate to high polarity due to the amine groups, which can engage in hydrogen bonding. Additionally, the ethyl and methyl substituents can affect the steric and electronic properties of the molecule, potentially impacting its biological activity and interaction with other chemical species. Overall, this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, owing to the structural features that suggest possible interactions with neurotransmitter systems.
Formula:C11H25N3
InChI:InChI=1S/C11H25N3/c1-3-14(8-6-12)10-11-5-4-7-13(2)9-11/h11H,3-10,12H2,1-2H3
InChI key:InChIKey=MIUWAOMCTHQMMU-UHFFFAOYSA-N
SMILES:C(N(CCN)CC)C1CN(C)CCC1
Synonyms:- 1,2-Ethanediamine, N1-ethyl-N1-[(1-methyl-3-piperidinyl)methyl]-
- N1-Ethyl-N1-[(1-methyl-3-piperidinyl)methyl]-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.